C17H17F5IN3O — CID 111807497
2-[2-(2,4-difluorophenyl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111807497) has the molecular formula C17H17F5IN3O and a molecular weight of 501.24 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenyl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807497 |
| Molecular Formula | C17H17F5IN3O |
| Molecular Weight | 501.24 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)Nc1ccc(OC(F)(F)F)cc1)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C17H16F5N3O.HI/c1-10(14-7-2-11(18)8-15(14)19)9-24-16(23)25-12-3-5-13(6-4-12)26-17(20,21)22;/h2-8,10H,9H2,1H3,(H3,23,24,25);1H |
| InChIKey | QYOYCGADFVETDO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|