C19H26F2N6 — CID 119159082
2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine (PubChem CID 119159082) has the molecular formula C19H26F2N6 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine.
| Compound Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
|---|---|
| PubChem CID | 119159082 |
| Molecular Formula | C19H26F2N6 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)cc1F)NC1CCCn2nc(C)nc21 |
| InChI | InChI=1S/C19H26F2N6/c1-4-22-19(23-11-12(2)15-8-7-14(20)10-16(15)21)25-17-6-5-9-27-18(17)24-13(3)26-27/h7-8,10,12,17H,4-6,9,11H2,1-3H3,(H2,22,23,25) |
| InChIKey | YLNUOJHHRZIERR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|