C15H18FN5O — CID 136513308
1-(4-fluoro-2-methylphenyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 136513308) has the molecular formula C15H18FN5O and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 136513308 |
| Molecular Formula | C15H18FN5O |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)Nc1ccc(F)cc1C |
| InChI | InChI=1S/C15H18FN5O/c1-9-8-11(16)5-6-12(9)18-15(22)19-13-4-3-7-21-14(13)17-10(2)20-21/h5-6,8,13H,3-4,7H2,1-2H3,(H2,18,19,22) |
| InChIKey | SAXHHQFVUHQREH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |