C20H19F2N5O2 — CID 126772268
1-[2-(3,5-difluorophenoxy)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 126772268) has the molecular formula C20H19F2N5O2 and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-[2-(3,5-difluorophenoxy)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 126772268 |
| Molecular Formula | C20H19F2N5O2 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)Nc1ccccc1Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H19F2N5O2/c1-12-23-19-17(6-4-8-27(19)26-12)25-20(28)24-16-5-2-3-7-18(16)29-15-10-13(21)9-14(22)11-15/h2-3,5,7,9-11,17H,4,6,8H2,1H3,(H2,24,25,28) |
| InChIKey | TWCPFHIUGCRAMR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |