C18H25N5O2 — CID 97102461
(3S)-N-(2-methoxyphenyl)-3-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]butanamide (PubChem CID 97102461) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3S)-N-(2-methoxyphenyl)-3-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]butanamide.
| Compound Name | (3S)-N-(2-methoxyphenyl)-3-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]butanamide |
|---|---|
| PubChem CID | 97102461 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (3S)-N-(2-methoxyphenyl)-3-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]butanamide |
| SMILES | COc1ccccc1NC(=O)C[C@H](C)N[C@@H]1CCCn2nc(C)nc21 |
| InChI | InChI=1S/C18H25N5O2/c1-12(11-17(24)21-14-7-4-5-9-16(14)25-3)19-15-8-6-10-23-18(15)20-13(2)22-23/h4-5,7,9,12,15,19H,6,8,10-11H2,1-3H3,(H,21,24)/t12-,15+/m0/s1 |
| InChIKey | YNGHAXOFYFTOTB-SWLSCSKDSA-N |
| XLogP | 2.44 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |