C12H19N2O2+ — CID 9396224
[(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]-methylazanium (PubChem CID 9396224) has the molecular formula C12H19N2O2+ and a molecular weight of 223.30 g/mol. Its IUPAC name is [(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]-methylazanium.
| Compound Name | [(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 9396224 |
| Molecular Formula | C12H19N2O2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]-methylazanium |
| SMILES | C[NH2+][C@@H](C)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C12H18N2O2/c1-9(13-2)8-12(15)14-10-6-4-5-7-11(10)16-3/h4-7,9,13H,8H2,1-3H3,(H,14,15)/p+1/t9-/m0/s1 |
| InChIKey | GSOIJDXAVUFZTG-VIFPVBQESA-O |
| XLogP | 0.61 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |