C14H20N2O4 — CID 7060622
(2R)-4-(2-methoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate (PubChem CID 7060622) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R)-4-(2-methoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate.
| Compound Name | (2R)-4-(2-methoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate |
|---|---|
| PubChem CID | 7060622 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2R)-4-(2-methoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate |
| SMILES | CCC[NH2+][C@H](CC(=O)Nc1ccccc1OC)C(=O)[O-] |
| InChI | InChI=1S/C14H20N2O4/c1-3-8-15-11(14(18)19)9-13(17)16-10-6-4-5-7-12(10)20-2/h4-7,11,15H,3,8-9H2,1-2H3,(H,16,17)(H,18,19)/t11-/m1/s1 |
| InChIKey | BKJQEKSVASCPST-LLVKDONJSA-N |
| XLogP | -0.88 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |