C13H16F2N2O3 — CID 7592540
(2R)-4-(2,4-difluoroanilino)-4-oxo-2-(propylazaniumyl)butanoate (PubChem CID 7592540) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2R)-4-(2,4-difluoroanilino)-4-oxo-2-(propylazaniumyl)butanoate.
| Compound Name | (2R)-4-(2,4-difluoroanilino)-4-oxo-2-(propylazaniumyl)butanoate |
|---|---|
| PubChem CID | 7592540 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R)-4-(2,4-difluoroanilino)-4-oxo-2-(propylazaniumyl)butanoate |
| SMILES | CCC[NH2+][C@H](CC(=O)Nc1ccc(F)cc1F)C(=O)[O-] |
| InChI | InChI=1S/C13H16F2N2O3/c1-2-5-16-11(13(19)20)7-12(18)17-10-4-3-8(14)6-9(10)15/h3-4,6,11,16H,2,5,7H2,1H3,(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | ZIRZYVQSIJQNTQ-LLVKDONJSA-N |
| XLogP | -0.61 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |