C15H22F2N3O3+ — CID 7592556
(2S)-4-(2,4-difluoroanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate (PubChem CID 7592556) has the molecular formula C15H22F2N3O3+ and a molecular weight of 330.36 g/mol. Its IUPAC name is (2S)-4-(2,4-difluoroanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(2,4-difluoroanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7592556 |
| Molecular Formula | C15H22F2N3O3+ |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S)-4-(2,4-difluoroanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate |
| SMILES | C[NH+](C)CCC[NH2+][C@@H](CC(=O)Nc1ccc(F)cc1F)C(=O)[O-] |
| InChI | InChI=1S/C15H21F2N3O3/c1-20(2)7-3-6-18-13(15(22)23)9-14(21)19-12-5-4-10(16)8-11(12)17/h4-5,8,13,18H,3,6-7,9H2,1-2H3,(H,19,21)(H,22,23)/p+1/t13-/m0/s1 |
| InChIKey | FXTWNTBAFVZJJQ-ZDUSSCGKSA-O |
| XLogP | -2.49 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|