C17H28N3O3+ — CID 7591635
(2R)-4-(3,5-dimethylanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate (PubChem CID 7591635) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is (2R)-4-(3,5-dimethylanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate.
| Compound Name | (2R)-4-(3,5-dimethylanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7591635 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2R)-4-(3,5-dimethylanilino)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxobutanoate |
| SMILES | Cc1cc(C)cc(NC(=O)C[C@@H]([NH2+]CCC[NH+](C)C)C(=O)[O-])c1 |
| InChI | InChI=1S/C17H27N3O3/c1-12-8-13(2)10-14(9-12)19-16(21)11-15(17(22)23)18-6-5-7-20(3)4/h8-10,15,18H,5-7,11H2,1-4H3,(H,19,21)(H,22,23)/p+1/t15-/m1/s1 |
| InChIKey | KSZYGJDWPWFKCT-OAHLLOKOSA-O |
| XLogP | -2.15 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|