C19H30N5O3S+ — CID 7592997
(2S)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoate (PubChem CID 7592997) has the molecular formula C19H30N5O3S+ and a molecular weight of 408.55 g/mol. Its IUPAC name is (2S)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoate.
| Compound Name | (2S)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoate |
|---|---|
| PubChem CID | 7592997 |
| Molecular Formula | C19H30N5O3S+ |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2S)-2-[3-(dimethylazaniumyl)propylazaniumyl]-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoate |
| SMILES | C=CCNC(=S)Nc1cccc(NC(=O)C[C@H]([NH2+]CCC[NH+](C)C)C(=O)[O-])c1 |
| InChI | InChI=1S/C19H29N5O3S/c1-4-9-21-19(28)23-15-8-5-7-14(12-15)22-17(25)13-16(18(26)27)20-10-6-11-24(2)3/h4-5,7-8,12,16,20H,1,6,9-11,13H2,2-3H3,(H,22,25)(H,26,27)(H2,21,23,28)/p+1/t16-/m0/s1 |
| InChIKey | SAYDGYSHSXIWGJ-INIZCTEOSA-O |
| XLogP | -2.30 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|