C14H22N3O4+ — CID 7591210
(2S)-4-(3-hydroxyanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate (PubChem CID 7591210) has the molecular formula C14H22N3O4+ and a molecular weight of 296.35 g/mol. Its IUPAC name is (2S)-4-(3-hydroxyanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(3-hydroxyanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7591210 |
| Molecular Formula | C14H22N3O4+ |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2S)-4-(3-hydroxyanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
| SMILES | C[NH2+]CCC[NH2+][C@@H](CC(=O)Nc1cccc(O)c1)C(=O)[O-] |
| InChI | InChI=1S/C14H21N3O4/c1-15-6-3-7-16-12(14(20)21)9-13(19)17-10-4-2-5-11(18)8-10/h2,4-5,8,12,15-16,18H,3,6-7,9H2,1H3,(H,17,19)(H,20,21)/p+1/t12-/m0/s1 |
| InChIKey | LNWCPKBSLUUEBW-LBPRGKRZSA-O |
| XLogP | -3.01 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|