C15H23N4O5+ — CID 7592040
(2S)-2-[3-(methylazaniumyl)propylazaniumyl]-4-(2-methyl-5-nitroanilino)-4-oxobutanoate (PubChem CID 7592040) has the molecular formula C15H23N4O5+ and a molecular weight of 339.37 g/mol. Its IUPAC name is (2S)-2-[3-(methylazaniumyl)propylazaniumyl]-4-(2-methyl-5-nitroanilino)-4-oxobutanoate.
| Compound Name | (2S)-2-[3-(methylazaniumyl)propylazaniumyl]-4-(2-methyl-5-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7592040 |
| Molecular Formula | C15H23N4O5+ |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2S)-2-[3-(methylazaniumyl)propylazaniumyl]-4-(2-methyl-5-nitroanilino)-4-oxobutanoate |
| SMILES | C[NH2+]CCC[NH2+][C@@H](CC(=O)Nc1cc([N+](=O)[O-])ccc1C)C(=O)[O-] |
| InChI | InChI=1S/C15H22N4O5/c1-10-4-5-11(19(23)24)8-12(10)18-14(20)9-13(15(21)22)17-7-3-6-16-2/h4-5,8,13,16-17H,3,6-7,9H2,1-2H3,(H,18,20)(H,21,22)/p+1/t13-/m0/s1 |
| InChIKey | AKDZWIIMFADRBZ-ZDUSSCGKSA-O |
| XLogP | -2.50 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|