C16H26N3O3+ — CID 7591554
(2S)-4-(2,3-dimethylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate (PubChem CID 7591554) has the molecular formula C16H26N3O3+ and a molecular weight of 308.40 g/mol. Its IUPAC name is (2S)-4-(2,3-dimethylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(2,3-dimethylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7591554 |
| Molecular Formula | C16H26N3O3+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2S)-4-(2,3-dimethylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
| SMILES | C[NH2+]CCC[NH2+][C@@H](CC(=O)Nc1cccc(C)c1C)C(=O)[O-] |
| InChI | InChI=1S/C16H25N3O3/c1-11-6-4-7-13(12(11)2)19-15(20)10-14(16(21)22)18-9-5-8-17-3/h4,6-7,14,17-18H,5,8-10H2,1-3H3,(H,19,20)(H,21,22)/p+1/t14-/m0/s1 |
| InChIKey | HLCQHIZKMVOPBC-AWEZNQCLSA-O |
| XLogP | -2.10 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|