C13H18Cl2N3O3+ — CID 7591810
(2S)-2-(3-azaniumylpropylazaniumyl)-4-(2,3-dichloroanilino)-4-oxobutanoate (PubChem CID 7591810) has the molecular formula C13H18Cl2N3O3+ and a molecular weight of 335.21 g/mol. Its IUPAC name is (2S)-2-(3-azaniumylpropylazaniumyl)-4-(2,3-dichloroanilino)-4-oxobutanoate.
| Compound Name | (2S)-2-(3-azaniumylpropylazaniumyl)-4-(2,3-dichloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7591810 |
| Molecular Formula | C13H18Cl2N3O3+ |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2S)-2-(3-azaniumylpropylazaniumyl)-4-(2,3-dichloroanilino)-4-oxobutanoate |
| SMILES | [NH3+]CCC[NH2+][C@@H](CC(=O)Nc1cccc(Cl)c1Cl)C(=O)[O-] |
| InChI | InChI=1S/C13H17Cl2N3O3/c14-8-3-1-4-9(12(8)15)18-11(19)7-10(13(20)21)17-6-2-5-16/h1,3-4,10,17H,2,5-7,16H2,(H,18,19)(H,20,21)/p+1/t10-/m0/s1 |
| InChIKey | VHUSNVCUXVZRQL-JTQLQIEISA-O |
| XLogP | -1.36 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|