C14H22N3O3+ — CID 7590900
(2R)-2-(2-azaniumylethylazaniumyl)-4-(4-ethylanilino)-4-oxobutanoate (PubChem CID 7590900) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is (2R)-2-(2-azaniumylethylazaniumyl)-4-(4-ethylanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(2-azaniumylethylazaniumyl)-4-(4-ethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7590900 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2R)-2-(2-azaniumylethylazaniumyl)-4-(4-ethylanilino)-4-oxobutanoate |
| SMILES | CCc1ccc(NC(=O)C[C@@H]([NH2+]CC[NH3+])C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H21N3O3/c1-2-10-3-5-11(6-4-10)17-13(18)9-12(14(19)20)16-8-7-15/h3-6,12,16H,2,7-9,15H2,1H3,(H,17,18)(H,19,20)/p+1/t12-/m1/s1 |
| InChIKey | JHHQUEXRKSCMEG-GFCCVEGCSA-O |
| XLogP | -2.50 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |