C20H34N3O3+ — CID 7590942
(2R)-2-(6-azaniumylhexylazaniumyl)-4-(4-butylanilino)-4-oxobutanoate (PubChem CID 7590942) has the molecular formula C20H34N3O3+ and a molecular weight of 364.51 g/mol. Its IUPAC name is (2R)-2-(6-azaniumylhexylazaniumyl)-4-(4-butylanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(4-butylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7590942 |
| Molecular Formula | C20H34N3O3+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(4-butylanilino)-4-oxobutanoate |
| SMILES | CCCCc1ccc(NC(=O)C[C@@H]([NH2+]CCCCCC[NH3+])C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H33N3O3/c1-2-3-8-16-9-11-17(12-10-16)23-19(24)15-18(20(25)26)22-14-7-5-4-6-13-21/h9-12,18,22H,2-8,13-15,21H2,1H3,(H,23,24)(H,25,26)/p+1/t18-/m1/s1 |
| InChIKey | WSFDMZGCPSASAS-GOSISDBHSA-O |
| XLogP | -0.16 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|