C16H26N3O4+ — CID 7591216
(2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-hydroxyanilino)-4-oxobutanoate (PubChem CID 7591216) has the molecular formula C16H26N3O4+ and a molecular weight of 324.40 g/mol. Its IUPAC name is (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-hydroxyanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-hydroxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7591216 |
| Molecular Formula | C16H26N3O4+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-hydroxyanilino)-4-oxobutanoate |
| SMILES | [NH3+]CCCCCC[NH2+][C@H](CC(=O)Nc1cccc(O)c1)C(=O)[O-] |
| InChI | InChI=1S/C16H25N3O4/c17-8-3-1-2-4-9-18-14(16(22)23)11-15(21)19-12-6-5-7-13(20)10-12/h5-7,10,14,18,20H,1-4,8-9,11,17H2,(H,19,21)(H,22,23)/p+1/t14-/m1/s1 |
| InChIKey | FQRDSUFMHWJXLH-CQSZACIVSA-O |
| XLogP | -1.79 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|