C17H28N3O3+ — CID 7590871
(2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-methylanilino)-4-oxobutanoate (PubChem CID 7590871) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-methylanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-methylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7590871 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2R)-2-(6-azaniumylhexylazaniumyl)-4-(3-methylanilino)-4-oxobutanoate |
| SMILES | Cc1cccc(NC(=O)C[C@@H]([NH2+]CCCCCC[NH3+])C(=O)[O-])c1 |
| InChI | InChI=1S/C17H27N3O3/c1-13-7-6-8-14(11-13)20-16(21)12-15(17(22)23)19-10-5-3-2-4-9-18/h6-8,11,15,19H,2-5,9-10,12,18H2,1H3,(H,20,21)(H,22,23)/p+1/t15-/m1/s1 |
| InChIKey | OQJNVVKURMHXKS-OAHLLOKOSA-O |
| XLogP | -1.19 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|