C19H23N3O5 — CID 7591218
(2S)-4-(3-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylazaniumyl]-4-oxobutanoate (PubChem CID 7591218) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2S)-4-(3-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(3-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7591218 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2S)-4-(3-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylazaniumyl]-4-oxobutanoate |
| SMILES | COc1ccccc1NCC[NH2+][C@@H](CC(=O)Nc1cccc(O)c1)C(=O)[O-] |
| InChI | InChI=1S/C19H23N3O5/c1-27-17-8-3-2-7-15(17)20-9-10-21-16(19(25)26)12-18(24)22-13-5-4-6-14(23)11-13/h2-8,11,16,20-21,23H,9-10,12H2,1H3,(H,22,24)(H,25,26)/t16-/m0/s1 |
| InChIKey | RMDGEOPKZAXCSZ-INIZCTEOSA-N |
| XLogP | -0.48 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|