C19H23N3O5 — CID 7591185
(2R)-4-(4-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylamino]-4-oxobutanoic acid (PubChem CID 7591185) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-4-(4-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7591185 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2R)-4-(4-hydroxyanilino)-2-[2-(2-methoxyanilino)ethylamino]-4-oxobutanoic acid |
| SMILES | COc1ccccc1NCCN[C@H](CC(=O)Nc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H23N3O5/c1-27-17-5-3-2-4-15(17)20-10-11-21-16(19(25)26)12-18(24)22-13-6-8-14(23)9-7-13/h2-9,16,20-21,23H,10-12H2,1H3,(H,22,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | XHLUJPISKUWZAY-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|