C17H22N4O4 — CID 40746574
(2R)-2-(3-imidazol-1-ylpropylamino)-4-(2-methoxyanilino)-4-oxobutanoic acid (PubChem CID 40746574) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is (2R)-2-(3-imidazol-1-ylpropylamino)-4-(2-methoxyanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-(3-imidazol-1-ylpropylamino)-4-(2-methoxyanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 40746574 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-2-(3-imidazol-1-ylpropylamino)-4-(2-methoxyanilino)-4-oxobutanoic acid |
| SMILES | COc1ccccc1NC(=O)C[C@@H](NCCCn1ccnc1)C(=O)O |
| InChI | InChI=1S/C17H22N4O4/c1-25-15-6-3-2-5-13(15)20-16(22)11-14(17(23)24)19-7-4-9-21-10-8-18-12-21/h2-3,5-6,8,10,12,14,19H,4,7,9,11H2,1H3,(H,20,22)(H,23,24)/t14-/m1/s1 |
| InChIKey | WTPUFUSKDFKFBO-CQSZACIVSA-N |
| XLogP | 1.35 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|