C16H20N4O4 — CID 27325397
(2S)-4-(3-hydroxyanilino)-2-(3-imidazol-1-ylpropylamino)-4-oxobutanoic acid (PubChem CID 27325397) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2S)-4-(3-hydroxyanilino)-2-(3-imidazol-1-ylpropylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-(3-hydroxyanilino)-2-(3-imidazol-1-ylpropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 27325397 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2S)-4-(3-hydroxyanilino)-2-(3-imidazol-1-ylpropylamino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](NCCCn1ccnc1)C(=O)O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H20N4O4/c21-13-4-1-3-12(9-13)19-15(22)10-14(16(23)24)18-5-2-7-20-8-6-17-11-20/h1,3-4,6,8-9,11,14,18,21H,2,5,7,10H2,(H,19,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | BLXNZWMFTLUWGY-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|