C12H17N4O5+ — CID 7592212
(2S)-2-(2-azaniumylethylazaniumyl)-4-(4-nitroanilino)-4-oxobutanoate (PubChem CID 7592212) has the molecular formula C12H17N4O5+ and a molecular weight of 297.29 g/mol. Its IUPAC name is (2S)-2-(2-azaniumylethylazaniumyl)-4-(4-nitroanilino)-4-oxobutanoate.
| Compound Name | (2S)-2-(2-azaniumylethylazaniumyl)-4-(4-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7592212 |
| Molecular Formula | C12H17N4O5+ |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2S)-2-(2-azaniumylethylazaniumyl)-4-(4-nitroanilino)-4-oxobutanoate |
| SMILES | [NH3+]CC[NH2+][C@@H](CC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H16N4O5/c13-5-6-14-10(12(18)19)7-11(17)15-8-1-3-9(4-2-8)16(20)21/h1-4,10,14H,5-7,13H2,(H,15,17)(H,18,19)/p+1/t10-/m0/s1 |
| InChIKey | JUDGQFLRIRWTGA-JTQLQIEISA-O |
| XLogP | -3.15 |
| TPSA | 156.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|