C14H20ClN4O5+ — CID 7592192
(2R)-4-(4-chloro-3-nitroanilino)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-oxobutanoate (PubChem CID 7592192) has the molecular formula C14H20ClN4O5+ and a molecular weight of 359.79 g/mol. Its IUPAC name is (2R)-4-(4-chloro-3-nitroanilino)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-oxobutanoate.
| Compound Name | (2R)-4-(4-chloro-3-nitroanilino)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7592192 |
| Molecular Formula | C14H20ClN4O5+ |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2R)-4-(4-chloro-3-nitroanilino)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-oxobutanoate |
| SMILES | C[NH+](C)CC[NH2+][C@H](CC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)C(=O)[O-] |
| InChI | InChI=1S/C14H19ClN4O5/c1-18(2)6-5-16-11(14(21)22)8-13(20)17-9-3-4-10(15)12(7-9)19(23)24/h3-4,7,11,16H,5-6,8H2,1-2H3,(H,17,20)(H,21,22)/p+1/t11-/m1/s1 |
| InChIKey | PBGSRYLEPTXKOZ-LLVKDONJSA-O |
| XLogP | -2.60 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|