C15H23ClN3O3+ — CID 7591756
(2S)-4-(3-chloro-4-methylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate (PubChem CID 7591756) has the molecular formula C15H23ClN3O3+ and a molecular weight of 328.82 g/mol. Its IUPAC name is (2S)-4-(3-chloro-4-methylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(3-chloro-4-methylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7591756 |
| Molecular Formula | C15H23ClN3O3+ |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S)-4-(3-chloro-4-methylanilino)-2-[3-(methylazaniumyl)propylazaniumyl]-4-oxobutanoate |
| SMILES | C[NH2+]CCC[NH2+][C@@H](CC(=O)Nc1ccc(C)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H22ClN3O3/c1-10-4-5-11(8-12(10)16)19-14(20)9-13(15(21)22)18-7-3-6-17-2/h4-5,8,13,17-18H,3,6-7,9H2,1-2H3,(H,19,20)(H,21,22)/p+1/t13-/m0/s1 |
| InChIKey | GQCACLHMRMEUCP-ZDUSSCGKSA-O |
| XLogP | -1.76 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|