C16H23ClN2O3 — CID 7166341
(2R)-4-(5-chloro-2-methylanilino)-4-oxo-2-(pentylazaniumyl)butanoate (PubChem CID 7166341) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is (2R)-4-(5-chloro-2-methylanilino)-4-oxo-2-(pentylazaniumyl)butanoate.
| Compound Name | (2R)-4-(5-chloro-2-methylanilino)-4-oxo-2-(pentylazaniumyl)butanoate |
|---|---|
| PubChem CID | 7166341 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2R)-4-(5-chloro-2-methylanilino)-4-oxo-2-(pentylazaniumyl)butanoate |
| SMILES | CCCCC[NH2+][C@H](CC(=O)Nc1cc(Cl)ccc1C)C(=O)[O-] |
| InChI | InChI=1S/C16H23ClN2O3/c1-3-4-5-8-18-14(16(21)22)10-15(20)19-13-9-12(17)7-6-11(13)2/h6-7,9,14,18H,3-5,8,10H2,1-2H3,(H,19,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | HTJYHIFENAQMHW-CQSZACIVSA-N |
| XLogP | 0.85 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|