C16H22N2O6 — CID 7591473
(2S)-4-(4-ethoxycarbonylanilino)-2-(3-hydroxypropylazaniumyl)-4-oxobutanoate (PubChem CID 7591473) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2S)-4-(4-ethoxycarbonylanilino)-2-(3-hydroxypropylazaniumyl)-4-oxobutanoate.
| Compound Name | (2S)-4-(4-ethoxycarbonylanilino)-2-(3-hydroxypropylazaniumyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7591473 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2S)-4-(4-ethoxycarbonylanilino)-2-(3-hydroxypropylazaniumyl)-4-oxobutanoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@H]([NH2+]CCCO)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O6/c1-2-24-16(23)11-4-6-12(7-5-11)18-14(20)10-13(15(21)22)17-8-3-9-19/h4-7,13,17,19H,2-3,8-10H2,1H3,(H,18,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | HGDNVIHHKPEJSP-ZDUSSCGKSA-N |
| XLogP | -1.74 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|