C16H20NO5- — CID 6957061
(2R)-5-(4-ethoxycarbonylanilino)-2-ethyl-5-oxopentanoate (PubChem CID 6957061) has the molecular formula C16H20NO5- and a molecular weight of 306.34 g/mol. Its IUPAC name is (2R)-5-(4-ethoxycarbonylanilino)-2-ethyl-5-oxopentanoate.
| Compound Name | (2R)-5-(4-ethoxycarbonylanilino)-2-ethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 6957061 |
| Molecular Formula | C16H20NO5- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2R)-5-(4-ethoxycarbonylanilino)-2-ethyl-5-oxopentanoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC[C@@H](CC)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H21NO5/c1-3-11(15(19)20)7-10-14(18)17-13-8-5-12(6-9-13)16(21)22-4-2/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H,17,18)(H,19,20)/p-1/t11-/m1/s1 |
| InChIKey | XTZMIYZBHFHFDT-LLVKDONJSA-M |
| XLogP | 1.36 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |