C14H15NO5-2 — CID 3275763
4-(4-carboxylatohexanoylamino)benzoate (PubChem CID 3275763) has the molecular formula C14H15NO5-2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-(4-carboxylatohexanoylamino)benzoate.
| Compound Name | 4-(4-carboxylatohexanoylamino)benzoate |
|---|---|
| PubChem CID | 3275763 |
| Molecular Formula | C14H15NO5-2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-(4-carboxylatohexanoylamino)benzoate |
| SMILES | CCC(CCC(=O)Nc1ccc(C(=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C14H17NO5/c1-2-9(13(17)18)5-8-12(16)15-11-6-3-10(4-7-11)14(19)20/h3-4,6-7,9H,2,5,8H2,1H3,(H,15,16)(H,17,18)(H,19,20)/p-2 |
| InChIKey | DSBVWZKRZSRPKZ-UHFFFAOYSA-L |
| XLogP | -0.46 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |