C13H15ClNO3- — CID 6937397
(2S)-5-(2-chloroanilino)-2-ethyl-5-oxopentanoate (PubChem CID 6937397) has the molecular formula C13H15ClNO3- and a molecular weight of 268.72 g/mol. Its IUPAC name is (2S)-5-(2-chloroanilino)-2-ethyl-5-oxopentanoate.
| Compound Name | (2S)-5-(2-chloroanilino)-2-ethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 6937397 |
| Molecular Formula | C13H15ClNO3- |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2S)-5-(2-chloroanilino)-2-ethyl-5-oxopentanoate |
| SMILES | CC[C@@H](CCC(=O)Nc1ccccc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C13H16ClNO3/c1-2-9(13(17)18)7-8-12(16)15-11-6-4-3-5-10(11)14/h3-6,9H,2,7-8H2,1H3,(H,15,16)(H,17,18)/p-1/t9-/m0/s1 |
| InChIKey | SGAOPLDVXUIGHF-VIFPVBQESA-M |
| XLogP | 1.83 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |