C13H19ClN2O — CID 109013172
3-(butan-2-ylamino)-N-(2-chlorophenyl)propanamide (PubChem CID 109013172) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-(butan-2-ylamino)-N-(2-chlorophenyl)propanamide.
| Compound Name | 3-(butan-2-ylamino)-N-(2-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 109013172 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(butan-2-ylamino)-N-(2-chlorophenyl)propanamide |
| SMILES | CCC(C)NCCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-3-10(2)15-9-8-13(17)16-12-7-5-4-6-11(12)14/h4-7,10,15H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | YFFSHFYOKXEDQG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |