C16H21BrN2O4 — CID 40803216
ethyl 4-[3-[[(2S)-2-bromobutanoyl]amino]propanoylamino]benzoate (PubChem CID 40803216) has the molecular formula C16H21BrN2O4 and a molecular weight of 385.26 g/mol. Its IUPAC name is ethyl 4-[3-[[(2S)-2-bromobutanoyl]amino]propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[[(2S)-2-bromobutanoyl]amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 40803216 |
| Molecular Formula | C16H21BrN2O4 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | ethyl 4-[3-[[(2S)-2-bromobutanoyl]amino]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCNC(=O)[C@@H](Br)CC)cc1 |
| InChI | InChI=1S/C16H21BrN2O4/c1-3-13(17)15(21)18-10-9-14(20)19-12-7-5-11(6-8-12)16(22)23-4-2/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | ZERLPQYZJDNUKT-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|