C19H30N3O4+ — CID 7421952
(2S)-4-(4-ethylanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate (PubChem CID 7421952) has the molecular formula C19H30N3O4+ and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-4-(4-ethylanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate.
| Compound Name | (2S)-4-(4-ethylanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7421952 |
| Molecular Formula | C19H30N3O4+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2S)-4-(4-ethylanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate |
| SMILES | CCc1ccc(NC(=O)C[C@H]([NH2+]CCC[NH+]2CCOCC2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-2-15-4-6-16(7-5-15)21-18(23)14-17(19(24)25)20-8-3-9-22-10-12-26-13-11-22/h4-7,17,20H,2-3,8-14H2,1H3,(H,21,23)(H,24,25)/p+1/t17-/m0/s1 |
| InChIKey | NVEKNZBERXZGHW-KRWDZBQOSA-O |
| XLogP | -2.44 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|