C16H27N3O2+2 — CID 2119404
[2-(4-ethylanilino)-2-oxoethyl]-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 2119404) has the molecular formula C16H27N3O2+2 and a molecular weight of 293.41 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl]-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl]-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 2119404 |
| Molecular Formula | C16H27N3O2+2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl]-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | CCc1ccc(NC(=O)C[NH2+]CC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-2-14-3-5-15(6-4-14)18-16(20)13-17-7-8-19-9-11-21-12-10-19/h3-6,17H,2,7-13H2,1H3,(H,18,20)/p+2 |
| InChIKey | GNIZTKFMMWLZHZ-UHFFFAOYSA-P |
| XLogP | -1.33 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|