C20H23N3O3 — CID 110178513
N-[4-[(4-ethylphenyl)carbamoyl]phenyl]morpholine-4-carboxamide (PubChem CID 110178513) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[4-[(4-ethylphenyl)carbamoyl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[4-[(4-ethylphenyl)carbamoyl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110178513 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[4-[(4-ethylphenyl)carbamoyl]phenyl]morpholine-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc(NC(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-15-3-7-17(8-4-15)21-19(24)16-5-9-18(10-6-16)22-20(25)23-11-13-26-14-12-23/h3-10H,2,11-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | KETHXSJRXZWUKC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |