C17H20N4O2 — CID 53164786
4-ethyl-N-(2-morpholin-4-ylpyrimidin-5-yl)benzamide (PubChem CID 53164786) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-ethyl-N-(2-morpholin-4-ylpyrimidin-5-yl)benzamide.
| Compound Name | 4-ethyl-N-(2-morpholin-4-ylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 53164786 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-ethyl-N-(2-morpholin-4-ylpyrimidin-5-yl)benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cnc(N3CCOCC3)nc2)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-2-13-3-5-14(6-4-13)16(22)20-15-11-18-17(19-12-15)21-7-9-23-10-8-21/h3-6,11-12H,2,7-10H2,1H3,(H,20,22) |
| InChIKey | IGWCOCCTAPNKAL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |