C16H21N2O2+ — CID 8917889
[2-(4-ethylanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8917889) has the molecular formula C16H21N2O2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8917889 |
| Molecular Formula | C16H21N2O2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | CCc1ccc(NC(=O)C[NH2+][C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-13-6-8-14(9-7-13)18-16(19)11-17-12(2)15-5-4-10-20-15/h4-10,12,17H,3,11H2,1-2H3,(H,18,19)/p+1/t12-/m1/s1 |
| InChIKey | HBQWPFLLBGTDLC-GFCCVEGCSA-O |
| XLogP | 2.11 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |