C15H18N3O3+ — CID 8918378
[2-(4-carbamoylanilino)-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8918378) has the molecular formula C15H18N3O3+ and a molecular weight of 288.33 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8918378 |
| Molecular Formula | C15H18N3O3+ |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(C(N)=O)cc1)c1ccco1 |
| InChI | InChI=1S/C15H17N3O3/c1-10(13-3-2-8-21-13)17-9-14(19)18-12-6-4-11(5-7-12)15(16)20/h2-8,10,17H,9H2,1H3,(H2,16,20)(H,18,19)/p+1/t10-/m0/s1 |
| InChIKey | PETGTECHJKFDPQ-JTQLQIEISA-O |
| XLogP | 0.64 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |