C16H20N3O3+ — CID 8922088
[(1R)-1-(furan-2-yl)ethyl]-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 8922088) has the molecular formula C16H20N3O3+ and a molecular weight of 302.35 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)ethyl]-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(furan-2-yl)ethyl]-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8922088 |
| Molecular Formula | C16H20N3O3+ |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(1R)-1-(furan-2-yl)ethyl]-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | CNC(=O)c1ccc(NC(=O)C[NH2+][C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-11(14-4-3-9-22-14)18-10-15(20)19-13-7-5-12(6-8-13)16(21)17-2/h3-9,11,18H,10H2,1-2H3,(H,17,21)(H,19,20)/p+1/t11-/m1/s1 |
| InChIKey | SIDDPEDXPINHKB-LLVKDONJSA-O |
| XLogP | 0.90 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |