C17H25N4O6+ — CID 7166217
(2R)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate (PubChem CID 7166217) has the molecular formula C17H25N4O6+ and a molecular weight of 381.41 g/mol. Its IUPAC name is (2R)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7166217 |
| Molecular Formula | C17H25N4O6+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2R)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate |
| SMILES | O=C(C[C@@H]([NH2+]CCC[NH+]1CCOCC1)C(=O)[O-])Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N4O6/c22-16(19-13-3-1-4-14(11-13)21(25)26)12-15(17(23)24)18-5-2-6-20-7-9-27-10-8-20/h1,3-4,11,15,18H,2,5-10,12H2,(H,19,22)(H,23,24)/p+1/t15-/m1/s1 |
| InChIKey | ZQYKLUKRYPGMRQ-OAHLLOKOSA-O |
| XLogP | -3.09 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|