C16H21N3O5 — CID 7166228
(2R)-2-(cyclohexylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate (PubChem CID 7166228) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2R)-2-(cyclohexylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-(cyclohexylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7166228 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2R)-2-(cyclohexylazaniumyl)-4-(3-nitroanilino)-4-oxobutanoate |
| SMILES | O=C(C[C@@H]([NH2+]C1CCCCC1)C(=O)[O-])Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O5/c20-15(18-12-7-4-8-13(9-12)19(23)24)10-14(16(21)22)17-11-5-2-1-3-6-11/h4,7-9,11,14,17H,1-3,5-6,10H2,(H,18,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | PSGQMESPGAZUFV-CQSZACIVSA-N |
| XLogP | -0.06 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|