C12H16N3O4+ — CID 3575843
2-morpholin-4-ium-4-yl-N-(3-nitrophenyl)acetamide (PubChem CID 3575843) has the molecular formula C12H16N3O4+ and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-yl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-morpholin-4-ium-4-yl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3575843 |
| Molecular Formula | C12H16N3O4+ |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-morpholin-4-ium-4-yl-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCOCC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O4/c16-12(9-14-4-6-19-7-5-14)13-10-2-1-3-11(8-10)15(17)18/h1-3,8H,4-7,9H2,(H,13,16)/p+1 |
| InChIKey | GLCBWTFWQGOYQZ-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|