C14H19N4O4+ — CID 4069374
2-morpholin-4-ium-4-yl-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide (PubChem CID 4069374) has the molecular formula C14H19N4O4+ and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-yl-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide.
| Compound Name | 2-morpholin-4-ium-4-yl-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 4069374 |
| Molecular Formula | C14H19N4O4+ |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-morpholin-4-ium-4-yl-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)C[NH+]1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O4/c1-11(12-3-2-4-13(9-12)18(20)21)15-16-14(19)10-17-5-7-22-8-6-17/h2-4,9,15H,1,5-8,10H2,(H,16,19)/p+1 |
| InChIKey | UIPPAVGYGHMUOD-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|