C14H15N5O4 — CID 5216806
2-(3-methylidene-5-oxopyrazolidin-4-yl)-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide (PubChem CID 5216806) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-(3-methylidene-5-oxopyrazolidin-4-yl)-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide.
| Compound Name | 2-(3-methylidene-5-oxopyrazolidin-4-yl)-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 5216806 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(3-methylidene-5-oxopyrazolidin-4-yl)-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)CC1C(=C)NNC1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O4/c1-8(10-4-3-5-11(6-10)19(22)23)15-17-13(20)7-12-9(2)16-18-14(12)21/h3-6,12,15-16H,1-2,7H2,(H,17,20)(H,18,21) |
| InChIKey | YRIHMXQGNAEEDQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|