C18H21N4O3+ — CID 8590885
2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide (PubChem CID 8590885) has the molecular formula C18H21N4O3+ and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 8590885 |
| Molecular Formula | C18H21N4O3+ |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4O3/c23-18(19-15-4-2-1-3-5-15)14-20-10-12-21(13-11-20)16-6-8-17(9-7-16)22(24)25/h1-9H,10-14H2,(H,19,23)/p+1 |
| InChIKey | FFIKXIWKKIXFJT-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|