C19H20N5O3S+ — CID 7399269
N-(1,3-benzothiazol-2-yl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 7399269) has the molecular formula C19H20N5O3S+ and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7399269 |
| Molecular Formula | C19H20N5O3S+ |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19N5O3S/c25-18(21-19-20-16-3-1-2-4-17(16)28-19)13-22-9-11-23(12-10-22)14-5-7-15(8-6-14)24(26)27/h1-8H,9-13H2,(H,20,21,25)/p+1 |
| InChIKey | VEEHBOQNQBQPOO-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|