C12H9N5O3S — CID 1256176
N-(1,3-benzothiazol-2-yl)-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 1256176) has the molecular formula C12H9N5O3S and a molecular weight of 303.30 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 1256176 |
| Molecular Formula | C12H9N5O3S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H9N5O3S/c18-11(7-16-6-8(5-13-16)17(19)20)15-12-14-9-3-1-2-4-10(9)21-12/h1-6H,7H2,(H,14,15,18) |
| InChIKey | XIKVKXKBGDMTMV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|