C17H13N5OS — CID 162421443
N-(1,3-benzothiazol-2-yl)-2-(4-phenyltriazol-1-yl)acetamide (PubChem CID 162421443) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(4-phenyltriazol-1-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(4-phenyltriazol-1-yl)acetamide |
|---|---|
| PubChem CID | 162421443 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(4-phenyltriazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc(-c2ccccc2)nn1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H13N5OS/c23-16(19-17-18-13-8-4-5-9-15(13)24-17)11-22-10-14(20-21-22)12-6-2-1-3-7-12/h1-10H,11H2,(H,18,19,23) |
| InChIKey | PTIJDWFIBCXZPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |