C18H15N5O2S — CID 155528498
N-(1,3-benzothiazol-2-yl)-2-[4-(4-methoxyphenyl)triazol-1-yl]acetamide (PubChem CID 155528498) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[4-(4-methoxyphenyl)triazol-1-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[4-(4-methoxyphenyl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 155528498 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[4-(4-methoxyphenyl)triazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2cn(CC(=O)Nc3nc4ccccc4s3)nn2)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c1-25-13-8-6-12(7-9-13)15-10-23(22-21-15)11-17(24)20-18-19-14-4-2-3-5-16(14)26-18/h2-10H,11H2,1H3,(H,19,20,24) |
| InChIKey | YKZOPTNCXRDNRM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |